C54H40N4O4 — CID 20659194
O-[10-nitro-2,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]anthracen-9-yl]oxyhydroxylamine (PubChem CID 20659194) has the molecular formula C54H40N4O4 and a molecular weight of 808.94 g/mol. Its IUPAC name is O-[10-nitro-2,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]anthracen-9-yl]oxyhydroxylamine.
| Compound Name | O-[10-nitro-2,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]anthracen-9-yl]oxyhydroxylamine |
|---|---|
| PubChem CID | 20659194 |
| Molecular Formula | C54H40N4O4 |
| Molecular Weight | 808.94 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | O-[10-nitro-2,6-bis[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]anthracen-9-yl]oxyhydroxylamine |
| SMILES | NOOc1c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc2c([N+](=O)[O-])c2cc(/C=C/c3ccc(N(c4ccccc4)c4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C54H40N4O4/c55-62-61-54-50-36-30-41(23-21-39-25-31-47(32-26-39)56(43-13-5-1-6-14-43)44-15-7-2-8-16-44)37-51(50)53(58(59)60)49-35-29-42(38-52(49)54)24-22-40-27-33-48(34-28-40)57(45-17-9-3-10-18-45)46-19-11-4-12-20-46/h1-38H,55H2/b23-21+,24-22+ |
| InChIKey | VXUZVYIVSNSCBJ-MBALSZOMSA-N |
| XLogP | 14.37 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.94 |
| LogP ≤ 5 | 14.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|