C22H29ClFNO2 — CID 59956768
(Z)-6-[(2R,3S)-3-[[(4-chloro-2-fluorophenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid (PubChem CID 59956768) has the molecular formula C22H29ClFNO2 and a molecular weight of 393.93 g/mol. Its IUPAC name is (Z)-6-[(2R,3S)-3-[[(4-chloro-2-fluorophenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2R,3S)-3-[[(4-chloro-2-fluorophenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956768 |
| Molecular Formula | C22H29ClFNO2 |
| Molecular Weight | 393.93 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (Z)-6-[(2R,3S)-3-[[(4-chloro-2-fluorophenyl)methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1C2CCC(CC2)[C@@H]1CNCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H29ClFNO2/c23-18-11-10-17(21(24)12-18)13-25-14-20-16-8-6-15(7-9-16)19(20)4-2-1-3-5-22(26)27/h2,4,10-12,15-16,19-20,25H,1,3,5-9,13-14H2,(H,26,27)/b4-2-/t15?,16?,19-,20-/m0/s1 |
| InChIKey | ORYMDCJRFACULW-KJLKMCLGSA-N |
| XLogP | 5.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|