C23H29ClF3NO2 — CID 59956804
(Z)-6-[(2R,3S)-3-[[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid (PubChem CID 59956804) has the molecular formula C23H29ClF3NO2 and a molecular weight of 443.94 g/mol. Its IUPAC name is (Z)-6-[(2R,3S)-3-[[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(2R,3S)-3-[[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956804 |
| Molecular Formula | C23H29ClF3NO2 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (Z)-6-[(2R,3S)-3-[[[4-chloro-2-(trifluoromethyl)phenyl]methylamino]methyl]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1C2CCC(CC2)[C@@H]1CNCc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C23H29ClF3NO2/c24-18-11-10-17(21(12-18)23(25,26)27)13-28-14-20-16-8-6-15(7-9-16)19(20)4-2-1-3-5-22(29)30/h2,4,10-12,15-16,19-20,28H,1,3,5-9,13-14H2,(H,29,30)/b4-2-/t15?,16?,19-,20-/m0/s1 |
| InChIKey | DPEHCFPWKGHURG-KJLKMCLGSA-N |
| XLogP | 6.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|