C11H25NO — CID 59957248
4-methoxy-5,6-dimethyloctan-3-amine (PubChem CID 59957248) has the molecular formula C11H25NO and a molecular weight of 187.33 g/mol. Its IUPAC name is 4-methoxy-5,6-dimethyloctan-3-amine.
| Compound Name | 4-methoxy-5,6-dimethyloctan-3-amine |
|---|---|
| PubChem CID | 59957248 |
| Molecular Formula | C11H25NO |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | 4-methoxy-5,6-dimethyloctan-3-amine |
| SMILES | CCC(C)C(C)C(OC)C(N)CC |
| InChI | InChI=1S/C11H25NO/c1-6-8(3)9(4)11(13-5)10(12)7-2/h8-11H,6-7,12H2,1-5H3 |
| InChIKey | AMRNUPBBDCWGHI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |