About methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate
methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate (PubChem CID 59957611) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate |
| PubChem CID | 59957611 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate |
| SMILES | COC(=O)N/C(C)=C(/C)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C15H20N2O3/c1-9-6-7-13(10(2)8-9)17-14(18)11(3)12(4)16-15(19)20-5/h6-8H,1-5H3,(H,16,19)(H,17,18)/b12-11- |
| InChIKey | XBPBSOHRCITKMA-QXMHVHEDSA-N |
| XLogP | 2.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate?
The IUPAC name of methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate (CID 59957611) is methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate.
What is the SMILES notation for methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate?
The canonical SMILES for methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate is COC(=O)N/C(C)=C(/C)C(=O)Nc1ccc(C)cc1C.
What is the InChIKey of methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate?
The InChIKey is XBPBSOHRCITKMA-QXMHVHEDSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-9-6-7-13(10(2)8-9)17-14(18)11(3)12(4)16-15(19)20-5/h6-8H,1-5H3,(H,16,19)(H,17,18)/b12-11-.
What are the key properties of methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate?
methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate has a molecular weight of 276.34 g/mol, XLogP of 2.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(Z)-4-(2,4-dimethylanilino)-3-methyl-4-oxobut-2-en-2-yl]carbamate is sourced from PubChem (CID 59957611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).