C15H22N2 — CID 59957618
(3Z)-2-N-(2,4-dimethylphenyl)-4-N,3-dimethylpenta-1,3-diene-2,4-diamine (PubChem CID 59957618) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (3Z)-2-N-(2,4-dimethylphenyl)-4-N,3-dimethylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-2-N-(2,4-dimethylphenyl)-4-N,3-dimethylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 59957618 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (3Z)-2-N-(2,4-dimethylphenyl)-4-N,3-dimethylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(Nc1ccc(C)cc1C)/C(C)=C(/C)NC |
| InChI | InChI=1S/C15H22N2/c1-10-7-8-15(11(2)9-10)17-14(5)12(3)13(4)16-6/h7-9,16-17H,5H2,1-4,6H3/b13-12- |
| InChIKey | CUZRVJHDVQRHKO-SEYXRHQNSA-N |
| XLogP | 3.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|