C23H21N4O6+ — CID 59958885
4-[4-[[1-[4-(dihydroxymethyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]-3-methyl-5-oxo-4H-pyrazol-2-ium-1-yl]benzoic acid (PubChem CID 59958885) has the molecular formula C23H21N4O6+ and a molecular weight of 449.44 g/mol. Its IUPAC name is 4-[4-[[1-[4-(dihydroxymethyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]-3-methyl-5-oxo-4H-pyrazol-2-ium-1-yl]benzoic acid.
| Compound Name | 4-[4-[[1-[4-(dihydroxymethyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]-3-methyl-5-oxo-4H-pyrazol-2-ium-1-yl]benzoic acid |
|---|---|
| PubChem CID | 59958885 |
| Molecular Formula | C23H21N4O6+ |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-[4-[[1-[4-(dihydroxymethyl)phenyl]-3-methyl-5-oxopyrazol-4-ylidene]methyl]-3-methyl-5-oxo-4H-pyrazol-2-ium-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(C(O)O)cc2)C(=O)C1=CC1C(=O)N(c2ccc(C(=O)O)cc2)[NH+]=C1C |
| InChI | InChI=1S/C23H20N4O6/c1-12-18(20(28)26(24-12)16-7-3-14(4-8-16)22(30)31)11-19-13(2)25-27(21(19)29)17-9-5-15(6-10-17)23(32)33/h3-11,18,23,32-33H,1-2H3,(H,30,31)/p+1 |
| InChIKey | LIYCJULMNJWPDH-UHFFFAOYSA-O |
| XLogP | 0.14 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|