C23H23N — CID 59961059
(2S,3R)-1-benzhydryl-2-methyl-3-(2-methylphenyl)aziridine (PubChem CID 59961059) has the molecular formula C23H23N and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S,3R)-1-benzhydryl-2-methyl-3-(2-methylphenyl)aziridine.
| Compound Name | (2S,3R)-1-benzhydryl-2-methyl-3-(2-methylphenyl)aziridine |
|---|---|
| PubChem CID | 59961059 |
| Molecular Formula | C23H23N |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (2S,3R)-1-benzhydryl-2-methyl-3-(2-methylphenyl)aziridine |
| SMILES | Cc1ccccc1[C@@H]1[C@H](C)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23N/c1-17-11-9-10-16-21(17)22-18(2)24(22)23(19-12-5-3-6-13-19)20-14-7-4-8-15-20/h3-16,18,22-23H,1-2H3/t18-,22-,24?/m0/s1 |
| InChIKey | PINRNINNEDAOPD-OSKVEALZSA-N |
| XLogP | 5.53 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|