C40H47N4O6+ — CID 59961137
ethyl 4-[(2E,5E)-2,5-bis[(2Z)-2-(5,7,7-trimethyl-[1,3]dioxolo[4,5-f]indol-6-ylidene)ethylidene]cyclopentylidene]piperazin-4-ium-1-carboxylate (PubChem CID 59961137) has the molecular formula C40H47N4O6+ and a molecular weight of 679.84 g/mol. Its IUPAC name is ethyl 4-[(2E,5E)-2,5-bis[(2Z)-2-(5,7,7-trimethyl-[1,3]dioxolo[4,5-f]indol-6-ylidene)ethylidene]cyclopentylidene]piperazin-4-ium-1-carboxylate.
| Compound Name | ethyl 4-[(2E,5E)-2,5-bis[(2Z)-2-(5,7,7-trimethyl-[1,3]dioxolo[4,5-f]indol-6-ylidene)ethylidene]cyclopentylidene]piperazin-4-ium-1-carboxylate |
|---|---|
| PubChem CID | 59961137 |
| Molecular Formula | C40H47N4O6+ |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.35 |
| IUPAC Name | ethyl 4-[(2E,5E)-2,5-bis[(2Z)-2-(5,7,7-trimethyl-[1,3]dioxolo[4,5-f]indol-6-ylidene)ethylidene]cyclopentylidene]piperazin-4-ium-1-carboxylate |
| SMILES | CCOC(=O)N1CC[N+](=C2/C(=C/C=C3\N(C)c4cc5c(cc4C3(C)C)OCO5)CC/C2=C\C=C2/N(C)c3cc4c(cc3C2(C)C)OCO4)CC1 |
| InChI | InChI=1S/C40H47N4O6/c1-8-46-38(45)44-17-15-43(16-18-44)37-25(11-13-35-39(2,3)27-19-31-33(49-23-47-31)21-29(27)41(35)6)9-10-26(37)12-14-36-40(4,5)28-20-32-34(50-24-48-32)22-30(28)42(36)7/h11-14,19-22H,8-10,15-18,23-24H2,1-7H3/q+1 |
| InChIKey | XXASVGNJIOFQBL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 75.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|