C19H21N3O3 — CID 59961876
(5-methoxy-1-methylpyrazol-4-yl)-(2,3,4,8-tetramethyl-1-oxidoquinolin-1-ium-5-yl)methanone (PubChem CID 59961876) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (5-methoxy-1-methylpyrazol-4-yl)-(2,3,4,8-tetramethyl-1-oxidoquinolin-1-ium-5-yl)methanone.
| Compound Name | (5-methoxy-1-methylpyrazol-4-yl)-(2,3,4,8-tetramethyl-1-oxidoquinolin-1-ium-5-yl)methanone |
|---|---|
| PubChem CID | 59961876 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (5-methoxy-1-methylpyrazol-4-yl)-(2,3,4,8-tetramethyl-1-oxidoquinolin-1-ium-5-yl)methanone |
| SMILES | COc1c(C(=O)c2ccc(C)c3c2c(C)c(C)c(C)[n+]3[O-])cnn1C |
| InChI | InChI=1S/C19H21N3O3/c1-10-7-8-14(18(23)15-9-20-21(5)19(15)25-6)16-12(3)11(2)13(4)22(24)17(10)16/h7-9H,1-6H3 |
| InChIKey | NFYQVGRUPMLYGY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|