C29H30N4 — CID 59963142
5-[4-[(Z)-2-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-2H-tetrazole (PubChem CID 59963142) has the molecular formula C29H30N4 and a molecular weight of 434.59 g/mol. Its IUPAC name is 5-[4-[(Z)-2-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[4-[(Z)-2-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 59963142 |
| Molecular Formula | C29H30N4 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 5-[4-[(Z)-2-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]phenyl]-2H-tetrazole |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C(=C\c3ccc(-c4nn[nH]n4)cc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C29H30N4/c1-28(2)16-17-29(3,4)26-19-23(14-15-25(26)28)24(21-8-6-5-7-9-21)18-20-10-12-22(13-11-20)27-30-32-33-31-27/h5-15,18-19H,16-17H2,1-4H3,(H,30,31,32,33)/b24-18- |
| InChIKey | BNRUIBIQKISLTN-MOHJPFBDSA-N |
| XLogP | 6.80 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|