C26H30N4 — CID 20658747
5-[(1E)-1-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methylidene]-2,3-dihydroinden-5-yl]-2H-tetrazole (PubChem CID 20658747) has the molecular formula C26H30N4 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[(1E)-1-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methylidene]-2,3-dihydroinden-5-yl]-2H-tetrazole.
| Compound Name | 5-[(1E)-1-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methylidene]-2,3-dihydroinden-5-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 20658747 |
| Molecular Formula | C26H30N4 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 5-[(1E)-1-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methylidene]-2,3-dihydroinden-5-yl]-2H-tetrazole |
| SMILES | Cc1cc2c(cc1/C=C1\CCc3cc(-c4nn[nH]n4)ccc31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30N4/c1-16-12-22-23(26(4,5)11-10-25(22,2)3)15-20(16)14-18-7-6-17-13-19(8-9-21(17)18)24-27-29-30-28-24/h8-9,12-15H,6-7,10-11H2,1-5H3,(H,27,28,29,30)/b18-14+ |
| InChIKey | FRZSTBNOAFXWIF-NBVRZTHBSA-N |
| XLogP | 6.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|