C19H25F3O6S — CID 59964567
oxiran-2-ylmethyl 2,2-dimethyl-4-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]hexanoate (PubChem CID 59964567) has the molecular formula C19H25F3O6S and a molecular weight of 438.46 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2,2-dimethyl-4-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]hexanoate.
| Compound Name | oxiran-2-ylmethyl 2,2-dimethyl-4-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 59964567 |
| Molecular Formula | C19H25F3O6S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | oxiran-2-ylmethyl 2,2-dimethyl-4-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]hexanoate |
| SMILES | CCC(CC(C)(C)C(=O)OCC1CO1)c1ccc(S(=O)(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H25F3O6S/c1-4-13(9-18(2,3)17(23)27-11-15-10-26-15)14-5-7-16(8-6-14)29(24,25)28-12-19(20,21)22/h5-8,13,15H,4,9-12H2,1-3H3 |
| InChIKey | OTLCDBFQOSKWCR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|