C19H23F3O6S — CID 22982274
oxiran-2-ylmethyl 1-methyl-2-[1-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]propyl]cyclopropane-1-carboxylate (PubChem CID 22982274) has the molecular formula C19H23F3O6S and a molecular weight of 436.45 g/mol. Its IUPAC name is oxiran-2-ylmethyl 1-methyl-2-[1-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]propyl]cyclopropane-1-carboxylate.
| Compound Name | oxiran-2-ylmethyl 1-methyl-2-[1-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 22982274 |
| Molecular Formula | C19H23F3O6S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | oxiran-2-ylmethyl 1-methyl-2-[1-[4-(2,2,2-trifluoroethoxysulfonyl)phenyl]propyl]cyclopropane-1-carboxylate |
| SMILES | CCC(c1ccc(S(=O)(=O)OCC(F)(F)F)cc1)C1CC1(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C19H23F3O6S/c1-3-15(16-8-18(16,2)17(23)27-10-13-9-26-13)12-4-6-14(7-5-12)29(24,25)28-11-19(20,21)22/h4-7,13,15-16H,3,8-11H2,1-2H3 |
| InChIKey | KAUAPSQWXRWBQQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|