C28H35NO2 — CID 59967186
(6R,7R)-7-(4-hept-1-ynylnaphthalen-1-yl)-3,3-dimethyl-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 59967186) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is (6R,7R)-7-(4-hept-1-ynylnaphthalen-1-yl)-3,3-dimethyl-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R,7R)-7-(4-hept-1-ynylnaphthalen-1-yl)-3,3-dimethyl-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 59967186 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | (6R,7R)-7-(4-hept-1-ynylnaphthalen-1-yl)-3,3-dimethyl-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | CCCCCC#Cc1ccc([C@@H]2C3COC(C)(C)N3C(=O)[C@@H]2C(C)C)c2ccccc12 |
| InChI | InChI=1S/C28H35NO2/c1-6-7-8-9-10-13-20-16-17-23(22-15-12-11-14-21(20)22)26-24-18-31-28(4,5)29(24)27(30)25(26)19(2)3/h11-12,14-17,19,24-26H,6-9,18H2,1-5H3/t24?,25-,26-/m1/s1 |
| InChIKey | CJFOXEFADVGJSA-KPRFIHOGSA-N |
| XLogP | 6.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|