C20H32 — CID 59970598
(5Z,9E)-9-ethylidene-5,6,7,7,8,8-hexamethyldodeca-5,11-dien-1-yne (PubChem CID 59970598) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (5Z,9E)-9-ethylidene-5,6,7,7,8,8-hexamethyldodeca-5,11-dien-1-yne.
| Compound Name | (5Z,9E)-9-ethylidene-5,6,7,7,8,8-hexamethyldodeca-5,11-dien-1-yne |
|---|---|
| PubChem CID | 59970598 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (5Z,9E)-9-ethylidene-5,6,7,7,8,8-hexamethyldodeca-5,11-dien-1-yne |
| SMILES | C#CCC/C(C)=C(/C)C(C)(C)C(C)(C)/C(=C/C)CC=C |
| InChI | InChI=1S/C20H32/c1-10-13-15-16(4)17(5)19(6,7)20(8,9)18(12-3)14-11-2/h1,11-12H,2,13-15H2,3-9H3/b17-16-,18-12+ |
| InChIKey | QDHATMZGHQLUJX-JFXMLQPQSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|