C20H21FN4O — CID 59970991
(3Z)-4-[3-(diethylamino)prop-1-ynyl]-5-fluoro-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-1H-indol-2-one (PubChem CID 59970991) has the molecular formula C20H21FN4O and a molecular weight of 352.41 g/mol. Its IUPAC name is (3Z)-4-[3-(diethylamino)prop-1-ynyl]-5-fluoro-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-4-[3-(diethylamino)prop-1-ynyl]-5-fluoro-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 59970991 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (3Z)-4-[3-(diethylamino)prop-1-ynyl]-5-fluoro-3-[(5-methyl-1H-imidazol-4-yl)methylidene]-1H-indol-2-one |
| SMILES | CCN(CC)CC#Cc1c(F)ccc2c1/C(=C/c1nc[nH]c1C)C(=O)N2 |
| InChI | InChI=1S/C20H21FN4O/c1-4-25(5-2)10-6-7-14-16(21)8-9-17-19(14)15(20(26)24-17)11-18-13(3)22-12-23-18/h8-9,11-12H,4-5,10H2,1-3H3,(H,22,23)(H,24,26)/b15-11- |
| InChIKey | SAHWYXBQMKYHOE-PTNGSMBKSA-N |
| XLogP | 3.04 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|