C17H28O — CID 59977352
(6E,8E,10E)-4-methoxy-2,6,11-trimethyltrideca-2,6,8,10-tetraene (PubChem CID 59977352) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (6E,8E,10E)-4-methoxy-2,6,11-trimethyltrideca-2,6,8,10-tetraene.
| Compound Name | (6E,8E,10E)-4-methoxy-2,6,11-trimethyltrideca-2,6,8,10-tetraene |
|---|---|
| PubChem CID | 59977352 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (6E,8E,10E)-4-methoxy-2,6,11-trimethyltrideca-2,6,8,10-tetraene |
| SMILES | CC/C(C)=C/C=C/C=C(\C)CC(C=C(C)C)OC |
| InChI | InChI=1S/C17H28O/c1-7-15(4)10-8-9-11-16(5)13-17(18-6)12-14(2)3/h8-12,17H,7,13H2,1-6H3/b9-8+,15-10+,16-11+ |
| InChIKey | FDBZVJSPJMKAHS-BADRZPNPSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|