C18H28N2O5 — CID 59982571
[5-(ethylcarbamoyloxy)-3-phenylmethoxypentyl] N-ethylcarbamate (PubChem CID 59982571) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is [5-(ethylcarbamoyloxy)-3-phenylmethoxypentyl] N-ethylcarbamate.
| Compound Name | [5-(ethylcarbamoyloxy)-3-phenylmethoxypentyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 59982571 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [5-(ethylcarbamoyloxy)-3-phenylmethoxypentyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCCC(CCOC(=O)NCC)OCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O5/c1-3-19-17(21)23-12-10-16(11-13-24-18(22)20-4-2)25-14-15-8-6-5-7-9-15/h5-9,16H,3-4,10-14H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DVXBOHDBRRQRKI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |