C11H10Br2O3 — CID 59982742
(Z)-5-(2,5-dibromophenoxy)-4-hydroxypent-3-en-2-one (PubChem CID 59982742) has the molecular formula C11H10Br2O3 and a molecular weight of 350.01 g/mol. Its IUPAC name is (Z)-5-(2,5-dibromophenoxy)-4-hydroxypent-3-en-2-one.
| Compound Name | (Z)-5-(2,5-dibromophenoxy)-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 59982742 |
| Molecular Formula | C11H10Br2O3 |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.90 |
| IUPAC Name | (Z)-5-(2,5-dibromophenoxy)-4-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C(\O)COc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H10Br2O3/c1-7(14)4-9(15)6-16-11-5-8(12)2-3-10(11)13/h2-5,15H,6H2,1H3/b9-4- |
| InChIKey | PJQBLNSNEJTASX-WTKPLQERSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|