About (2,5-dibromophenyl) 2-chloroacetate
(2,5-dibromophenyl) 2-chloroacetate (PubChem CID 122539584) has the molecular formula C8H5Br2ClO2
and a molecular weight of 328.39 g/mol. Its IUPAC name is (2,5-dibromophenyl) 2-chloroacetate.
Molecular Properties
| Compound Name | (2,5-dibromophenyl) 2-chloroacetate |
| PubChem CID | 122539584 |
| Molecular Formula | C8H5Br2ClO2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 325.83 |
| IUPAC Name | (2,5-dibromophenyl) 2-chloroacetate |
| SMILES | O=C(CCl)Oc1cc(Br)ccc1Br |
| InChI | InChI=1S/C8H5Br2ClO2/c9-5-1-2-6(10)7(3-5)13-8(12)4-11/h1-3H,4H2 |
| InChIKey | SIRSNVBVOJRRML-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dibromophenyl) 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dibromophenyl) 2-chloroacetate?
The IUPAC name of (2,5-dibromophenyl) 2-chloroacetate (CID 122539584) is (2,5-dibromophenyl) 2-chloroacetate.
What is the SMILES notation for (2,5-dibromophenyl) 2-chloroacetate?
The canonical SMILES for (2,5-dibromophenyl) 2-chloroacetate is O=C(CCl)Oc1cc(Br)ccc1Br.
What is the InChIKey of (2,5-dibromophenyl) 2-chloroacetate?
The InChIKey is SIRSNVBVOJRRML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br2ClO2/c9-5-1-2-6(10)7(3-5)13-8(12)4-11/h1-3H,4H2.
What are the key properties of (2,5-dibromophenyl) 2-chloroacetate?
(2,5-dibromophenyl) 2-chloroacetate has a molecular weight of 328.39 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dibromophenyl) 2-chloroacetate is sourced from PubChem (CID 122539584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).