C11H15FN2S — CID 59986953
3-fluoro-4-(1-methylidene-1,4-thiazinan-4-yl)aniline (PubChem CID 59986953) has the molecular formula C11H15FN2S and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-fluoro-4-(1-methylidene-1,4-thiazinan-4-yl)aniline.
| Compound Name | 3-fluoro-4-(1-methylidene-1,4-thiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 59986953 |
| Molecular Formula | C11H15FN2S |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-fluoro-4-(1-methylidene-1,4-thiazinan-4-yl)aniline |
| SMILES | C=S1CCN(c2ccc(N)cc2F)CC1 |
| InChI | InChI=1S/C11H15FN2S/c1-15-6-4-14(5-7-15)11-3-2-9(13)8-10(11)12/h2-3,8H,1,4-7,13H2 |
| InChIKey | ZGLYWZBPKAUWRW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|