C18H21F2N5O2 — CID 59988071
N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]quinoxaline-2-carboxamide (PubChem CID 59988071) has the molecular formula C18H21F2N5O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]quinoxaline-2-carboxamide.
| Compound Name | N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 59988071 |
| Molecular Formula | C18H21F2N5O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]quinoxaline-2-carboxamide |
| SMILES | N[C@@H](CCCCNC(=O)c1cnc2ccccc2n1)C(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C18H21F2N5O2/c19-18(20)10-25(11-18)17(27)12(21)5-3-4-8-22-16(26)15-9-23-13-6-1-2-7-14(13)24-15/h1-2,6-7,9,12H,3-5,8,10-11,21H2,(H,22,26)/t12-/m0/s1 |
| InChIKey | BSRUTMJGHRIMRS-LBPRGKRZSA-N |
| XLogP | 1.33 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|