C18H19F4N5O2 — CID 59988064
N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]-6,7-difluoroquinoxaline-2-carboxamide (PubChem CID 59988064) has the molecular formula C18H19F4N5O2 and a molecular weight of 413.38 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]-6,7-difluoroquinoxaline-2-carboxamide.
| Compound Name | N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]-6,7-difluoroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 59988064 |
| Molecular Formula | C18H19F4N5O2 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[(5S)-5-amino-6-(3,3-difluoroazetidin-1-yl)-6-oxohexyl]-6,7-difluoroquinoxaline-2-carboxamide |
| SMILES | N[C@@H](CCCCNC(=O)c1cnc2cc(F)c(F)cc2n1)C(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C18H19F4N5O2/c19-10-5-13-14(6-11(10)20)26-15(7-25-13)16(28)24-4-2-1-3-12(23)17(29)27-8-18(21,22)9-27/h5-7,12H,1-4,8-9,23H2,(H,24,28)/t12-/m0/s1 |
| InChIKey | GCCNOTMNSUFTKO-LBPRGKRZSA-N |
| XLogP | 1.61 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|