C17H20F5N3O2 — CID 11502070
N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-fluorobenzamide (PubChem CID 11502070) has the molecular formula C17H20F5N3O2 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-fluorobenzamide.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 11502070 |
| Molecular Formula | C17H20F5N3O2 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-3-fluorobenzamide |
| SMILES | N[C@@H](CCCCNC(=O)c1cccc(F)c1)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C17H20F5N3O2/c18-12-5-3-4-11(8-12)14(26)24-7-2-1-6-13(23)15(27)25-9-16(19,20)17(21,22)10-25/h3-5,8,13H,1-2,6-7,9-10,23H2,(H,24,26)/t13-/m0/s1 |
| InChIKey | RHHRHPXOXGLCEJ-ZDUSSCGKSA-N |
| XLogP | 2.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|