C22H33F2N5O2 — CID 143006347
N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-5-methyl-1-[(E)-prop-1-enyl]pyrazole-4-carboxamide;buta-1,3-diene (PubChem CID 143006347) has the molecular formula C22H33F2N5O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-5-methyl-1-[(E)-prop-1-enyl]pyrazole-4-carboxamide;buta-1,3-diene.
| Compound Name | N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-5-methyl-1-[(E)-prop-1-enyl]pyrazole-4-carboxamide;buta-1,3-diene |
|---|---|
| PubChem CID | 143006347 |
| Molecular Formula | C22H33F2N5O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | N-[5-amino-6-(3,3-difluoropyrrolidin-1-yl)-6-oxohexyl]-5-methyl-1-[(E)-prop-1-enyl]pyrazole-4-carboxamide;buta-1,3-diene |
| SMILES | C/C=C/n1ncc(C(=O)NCCCCC(N)C(=O)N2CCC(F)(F)C2)c1C.C=CC=C |
| InChI | InChI=1S/C18H27F2N5O2.C4H6/c1-3-9-25-13(2)14(11-23-25)16(26)22-8-5-4-6-15(21)17(27)24-10-7-18(19,20)12-24;1-3-4-2/h3,9,11,15H,4-8,10,12,21H2,1-2H3,(H,22,26);3-4H,1-2H2/b9-3+; |
| InChIKey | KVTTVVKECCILAL-JSGFVSQVSA-N |
| XLogP | 3.14 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|