C16H22ClF4N3O2S — CID 87984941
N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-2-thiophen-2-ylacetamide;hydrochloride (PubChem CID 87984941) has the molecular formula C16H22ClF4N3O2S and a molecular weight of 431.88 g/mol. Its IUPAC name is N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-2-thiophen-2-ylacetamide;hydrochloride.
| Compound Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-2-thiophen-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 87984941 |
| Molecular Formula | C16H22ClF4N3O2S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-[(5S)-5-amino-6-oxo-6-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexyl]-2-thiophen-2-ylacetamide;hydrochloride |
| SMILES | Cl.N[C@@H](CCCCNC(=O)Cc1cccs1)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C16H21F4N3O2S.ClH/c17-15(18)9-23(10-16(15,19)20)14(25)12(21)5-1-2-6-22-13(24)8-11-4-3-7-26-11;/h3-4,7,12H,1-2,5-6,8-10,21H2,(H,22,24);1H/t12-;/m0./s1 |
| InChIKey | ZWMNMZMLFCXGON-YDALLXLXSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|