C34H49N2O2+ — CID 59989698
[(2S)-2-(dimethylamino)-3-phenylpropyl]-dimethyl-[8-(4-phenylmethoxyphenoxy)octyl]azanium (PubChem CID 59989698) has the molecular formula C34H49N2O2+ and a molecular weight of 517.78 g/mol. Its IUPAC name is [(2S)-2-(dimethylamino)-3-phenylpropyl]-dimethyl-[8-(4-phenylmethoxyphenoxy)octyl]azanium.
| Compound Name | [(2S)-2-(dimethylamino)-3-phenylpropyl]-dimethyl-[8-(4-phenylmethoxyphenoxy)octyl]azanium |
|---|---|
| PubChem CID | 59989698 |
| Molecular Formula | C34H49N2O2+ |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.38 |
| IUPAC Name | [(2S)-2-(dimethylamino)-3-phenylpropyl]-dimethyl-[8-(4-phenylmethoxyphenoxy)octyl]azanium |
| SMILES | CN(C)[C@@H](Cc1ccccc1)C[N+](C)(C)CCCCCCCCOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H49N2O2/c1-35(2)32(27-30-17-11-9-12-18-30)28-36(3,4)25-15-7-5-6-8-16-26-37-33-21-23-34(24-22-33)38-29-31-19-13-10-14-20-31/h9-14,17-24,32H,5-8,15-16,25-29H2,1-4H3/q+1/t32-/m0/s1 |
| InChIKey | FGGQKMZXGYDYGI-YTTGMZPUSA-N |
| XLogP | 7.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|