C14H29N3 — CID 59996905
3,5-ditert-butyl-2,4,4a,6,7,7a-hexahydro-1H-pyrrolo[3,2-d]pyrimidine (PubChem CID 59996905) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is 3,5-ditert-butyl-2,4,4a,6,7,7a-hexahydro-1H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 3,5-ditert-butyl-2,4,4a,6,7,7a-hexahydro-1H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 59996905 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | 3,5-ditert-butyl-2,4,4a,6,7,7a-hexahydro-1H-pyrrolo[3,2-d]pyrimidine |
| SMILES | CC(C)(C)N1CNC2CCN(C(C)(C)C)C2C1 |
| InChI | InChI=1S/C14H29N3/c1-13(2,3)16-9-12-11(15-10-16)7-8-17(12)14(4,5)6/h11-12,15H,7-10H2,1-6H3 |
| InChIKey | CVDJCBOHUAQVDA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |