C22H23Cl2NO4 — CID 59997938
ethyl (2Z)-2-[[3-[2-(2,4-dichloroanilino)-2-oxoethyl]-4-methoxyphenyl]methylidene]butanoate (PubChem CID 59997938) has the molecular formula C22H23Cl2NO4 and a molecular weight of 436.34 g/mol. Its IUPAC name is ethyl (2Z)-2-[[3-[2-(2,4-dichloroanilino)-2-oxoethyl]-4-methoxyphenyl]methylidene]butanoate.
| Compound Name | ethyl (2Z)-2-[[3-[2-(2,4-dichloroanilino)-2-oxoethyl]-4-methoxyphenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 59997938 |
| Molecular Formula | C22H23Cl2NO4 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | ethyl (2Z)-2-[[3-[2-(2,4-dichloroanilino)-2-oxoethyl]-4-methoxyphenyl]methylidene]butanoate |
| SMILES | CCOC(=O)/C(=C\c1ccc(OC)c(CC(=O)Nc2ccc(Cl)cc2Cl)c1)CC |
| InChI | InChI=1S/C22H23Cl2NO4/c1-4-15(22(27)29-5-2)10-14-6-9-20(28-3)16(11-14)12-21(26)25-19-8-7-17(23)13-18(19)24/h6-11,13H,4-5,12H2,1-3H3,(H,25,26)/b15-10- |
| InChIKey | NQWMYDWUPJRVBI-GDNBJRDFSA-N |
| XLogP | 5.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|