C17H20N6 — CID 6000889
(3E)-N-(2,4-dimethylanilino)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-carboximidoyl cyanide (PubChem CID 6000889) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is (3E)-N-(2,4-dimethylanilino)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-carboximidoyl cyanide.
| Compound Name | (3E)-N-(2,4-dimethylanilino)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-carboximidoyl cyanide |
|---|---|
| PubChem CID | 6000889 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3E)-N-(2,4-dimethylanilino)-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine-3-carboximidoyl cyanide |
| SMILES | Cc1ccc(N/N=C(\C#N)c2nnc3n2CCCCC3)c(C)c1 |
| InChI | InChI=1S/C17H20N6/c1-12-7-8-14(13(2)10-12)19-20-15(11-18)17-22-21-16-6-4-3-5-9-23(16)17/h7-8,10,19H,3-6,9H2,1-2H3/b20-15+ |
| InChIKey | GMEMVBMSGJEFSX-HMMYKYKNSA-N |
| XLogP | 2.96 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|