C11H8Cl2N4O — CID 6008904
(E)-3-(2,6-dichlorophenyl)-N-(1,2,4-triazol-4-yl)prop-2-enamide (PubChem CID 6008904) has the molecular formula C11H8Cl2N4O and a molecular weight of 283.12 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-(1,2,4-triazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-(1,2,4-triazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6008904 |
| Molecular Formula | C11H8Cl2N4O |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-(1,2,4-triazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)Nn1cnnc1 |
| InChI | InChI=1S/C11H8Cl2N4O/c12-9-2-1-3-10(13)8(9)4-5-11(18)16-17-6-14-15-7-17/h1-7H,(H,16,18)/b5-4+ |
| InChIKey | RDVFSSHORPFMPT-SNAWJCMRSA-N |
| XLogP | 2.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|