C13H10ClN3O3 — CID 6020485
(2E,4E)-6-amino-2-anilino-3-chloro-5-cyano-6-oxohexa-2,4-dienoic acid (PubChem CID 6020485) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is (2E,4E)-6-amino-2-anilino-3-chloro-5-cyano-6-oxohexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-amino-2-anilino-3-chloro-5-cyano-6-oxohexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 6020485 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | (2E,4E)-6-amino-2-anilino-3-chloro-5-cyano-6-oxohexa-2,4-dienoic acid |
| SMILES | N#C/C(=C\C(Cl)=C(/Nc1ccccc1)C(=O)O)C(N)=O |
| InChI | InChI=1S/C13H10ClN3O3/c14-10(6-8(7-15)12(16)18)11(13(19)20)17-9-4-2-1-3-5-9/h1-6,17H,(H2,16,18)(H,19,20)/b8-6+,11-10+ |
| InChIKey | WWRYDBXGUPXFER-UMYLGFLZSA-N |
| XLogP | 1.57 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|