C18H12N2O — CID 100985108
(E)-2-cyano-N,5-diphenylpent-2-en-4-ynamide (PubChem CID 100985108) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is (E)-2-cyano-N,5-diphenylpent-2-en-4-ynamide.
| Compound Name | (E)-2-cyano-N,5-diphenylpent-2-en-4-ynamide |
|---|---|
| PubChem CID | 100985108 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (E)-2-cyano-N,5-diphenylpent-2-en-4-ynamide |
| SMILES | N#C/C(=C\C#Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H12N2O/c19-14-16(11-7-10-15-8-3-1-4-9-15)18(21)20-17-12-5-2-6-13-17/h1-6,8-9,11-13H,(H,20,21)/b16-11+ |
| InChIKey | GQVBIGHXPYZKLQ-LFIBNONCSA-N |
| XLogP | 3.13 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|