C11H8Cl2N6O2 — CID 6021592
4-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine (PubChem CID 6021592) has the molecular formula C11H8Cl2N6O2 and a molecular weight of 327.13 g/mol. Its IUPAC name is 4-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 6021592 |
| Molecular Formula | C11H8Cl2N6O2 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(N/N=C\c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8Cl2N6O2/c12-7-2-1-6(8(13)3-7)4-17-18-11-9(19(20)21)10(14)15-5-16-11/h1-5H,(H3,14,15,16,18)/b17-4- |
| InChIKey | RQTVURRRDLWOOK-INGKJJEOSA-N |
| XLogP | 2.72 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|