C12H12N6O3 — CID 4091220
4-N-[(4-methoxyphenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine (PubChem CID 4091220) has the molecular formula C12H12N6O3 and a molecular weight of 288.27 g/mol. Its IUPAC name is 4-N-[(4-methoxyphenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(4-methoxyphenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 4091220 |
| Molecular Formula | C12H12N6O3 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-N-[(4-methoxyphenyl)methylideneamino]-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc(C=NNc2ncnc(N)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H12N6O3/c1-21-9-4-2-8(3-5-9)6-16-17-12-10(18(19)20)11(13)14-7-15-12/h2-7H,1H3,(H3,13,14,15,17) |
| InChIKey | LXDJDJRVNJAAHS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|