C10H10F5O3P — CID 602253
1-[[ethoxy(methyl)phosphoryl]oxymethyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 602253) has the molecular formula C10H10F5O3P and a molecular weight of 304.15 g/mol. Its IUPAC name is 1-[[ethoxy(methyl)phosphoryl]oxymethyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[[ethoxy(methyl)phosphoryl]oxymethyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 602253 |
| Molecular Formula | C10H10F5O3P |
| Molecular Weight | 304.15 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 1-[[ethoxy(methyl)phosphoryl]oxymethyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCOP(C)(=O)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H10F5O3P/c1-3-17-19(2,16)18-4-5-6(11)8(13)10(15)9(14)7(5)12/h3-4H2,1-2H3 |
| InChIKey | AUEXHZCOVPGGMI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.15 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|