C17H20O5Se — CID 602543
ethyl 8-oxo-7-phenylselanyl-1,4-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 602543) has the molecular formula C17H20O5Se and a molecular weight of 383.30 g/mol. Its IUPAC name is ethyl 8-oxo-7-phenylselanyl-1,4-dioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | ethyl 8-oxo-7-phenylselanyl-1,4-dioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 602543 |
| Molecular Formula | C17H20O5Se |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | ethyl 8-oxo-7-phenylselanyl-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| SMILES | CCOC(=O)C1([Se]c2ccccc2)CC2(CCC1=O)OCCO2 |
| InChI | InChI=1S/C17H20O5Se/c1-2-20-15(19)17(23-13-6-4-3-5-7-13)12-16(9-8-14(17)18)21-10-11-22-16/h3-7H,2,8-12H2,1H3 |
| InChIKey | PQZYKDWQTQHRCU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|