C17H22O4Se — CID 141398516
1-phenylselanylethyl 1,4-dioxaspiro[4.5]decane-8-carboxylate (PubChem CID 141398516) has the molecular formula C17H22O4Se and a molecular weight of 369.32 g/mol. Its IUPAC name is 1-phenylselanylethyl 1,4-dioxaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1-phenylselanylethyl 1,4-dioxaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 141398516 |
| Molecular Formula | C17H22O4Se |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-phenylselanylethyl 1,4-dioxaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(OC(=O)C1CCC2(CC1)OCCO2)[Se]c1ccccc1 |
| InChI | InChI=1S/C17H22O4Se/c1-13(22-15-5-3-2-4-6-15)21-16(18)14-7-9-17(10-8-14)19-11-12-20-17/h2-6,13-14H,7-12H2,1H3 |
| InChIKey | PSNYNJVHAPBWFW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|