C17H20O4Se — CID 567230
3'-phenylseleninylspiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]nonane]-2'-one (PubChem CID 567230) has the molecular formula C17H20O4Se and a molecular weight of 367.30 g/mol. Its IUPAC name is 3'-phenylseleninylspiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]nonane]-2'-one.
| Compound Name | 3'-phenylseleninylspiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]nonane]-2'-one |
|---|---|
| PubChem CID | 567230 |
| Molecular Formula | C17H20O4Se |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3'-phenylseleninylspiro[1,3-dioxolane-2,6'-bicyclo[3.3.1]nonane]-2'-one |
| SMILES | O=C1C2CCC3(OCCO3)C(C2)CC1[Se](=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O4Se/c18-16-12-6-7-17(20-8-9-21-17)13(10-12)11-15(16)22(19)14-4-2-1-3-5-14/h1-5,12-13,15H,6-11H2 |
| InChIKey | PCQZGSWAKXCYHF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|