C17H18O3 — CID 134945837
(4'R)-4'-phenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-9'-one (PubChem CID 134945837) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4'R)-4'-phenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-9'-one.
| Compound Name | (4'R)-4'-phenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-9'-one |
|---|---|
| PubChem CID | 134945837 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (4'R)-4'-phenylspiro[1,3-dioxolane-2,7'-bicyclo[3.3.1]non-2-ene]-9'-one |
| SMILES | O=C1C2C=C[C@@H](c3ccccc3)C1CC1(C2)OCCO1 |
| InChI | InChI=1S/C17H18O3/c18-16-13-6-7-14(12-4-2-1-3-5-12)15(16)11-17(10-13)19-8-9-20-17/h1-7,13-15H,8-11H2/t13?,14-,15?/m0/s1 |
| InChIKey | CDGOVAICQCPQCN-SLTAFYQDSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|