C20H24O4Se — CID 10476468
(1'S,6'S)-3'-phenylseleninylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one (PubChem CID 10476468) has the molecular formula C20H24O4Se and a molecular weight of 407.37 g/mol. Its IUPAC name is (1'S,6'S)-3'-phenylseleninylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one.
| Compound Name | (1'S,6'S)-3'-phenylseleninylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one |
|---|---|
| PubChem CID | 10476468 |
| Molecular Formula | C20H24O4Se |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (1'S,6'S)-3'-phenylseleninylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one |
| SMILES | O=C1C([Se](=O)c2ccccc2)CC[C@H]2CC3C[C@]12CCC31OCCO1 |
| InChI | InChI=1S/C20H24O4Se/c21-18-17(25(22)16-4-2-1-3-5-16)7-6-14-12-15-13-19(14,18)8-9-20(15)23-10-11-24-20/h1-5,14-15,17H,6-13H2/t14-,15?,17?,19-,25?/m0/s1 |
| InChIKey | SRQKBTVAGZHSAO-VCYLPXADSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|