C15H18O3Se — CID 10471534
6-(phenylselanylmethyl)-1,4-dioxaspiro[4.5]decan-7-one (PubChem CID 10471534) has the molecular formula C15H18O3Se and a molecular weight of 325.27 g/mol. Its IUPAC name is 6-(phenylselanylmethyl)-1,4-dioxaspiro[4.5]decan-7-one.
| Compound Name | 6-(phenylselanylmethyl)-1,4-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 10471534 |
| Molecular Formula | C15H18O3Se |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 6-(phenylselanylmethyl)-1,4-dioxaspiro[4.5]decan-7-one |
| SMILES | O=C1CCCC2(OCCO2)C1C[Se]c1ccccc1 |
| InChI | InChI=1S/C15H18O3Se/c16-14-7-4-8-15(17-9-10-18-15)13(14)11-19-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2 |
| InChIKey | URMQZVWROPXONK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|