C15H18O3 — CID 135087001
8-(3-methylphenyl)-1,4-dioxaspiro[4.5]decan-7-one (PubChem CID 135087001) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 8-(3-methylphenyl)-1,4-dioxaspiro[4.5]decan-7-one.
| Compound Name | 8-(3-methylphenyl)-1,4-dioxaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 135087001 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 8-(3-methylphenyl)-1,4-dioxaspiro[4.5]decan-7-one |
| SMILES | Cc1cccc(C2CCC3(CC2=O)OCCO3)c1 |
| InChI | InChI=1S/C15H18O3/c1-11-3-2-4-12(9-11)13-5-6-15(10-14(13)16)17-7-8-18-15/h2-4,9,13H,5-8,10H2,1H3 |
| InChIKey | GPVKLRMUWJCFJL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |