C20H24O3Se — CID 10408121
(1'S,6'S)-3'-phenylselanylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one (PubChem CID 10408121) has the molecular formula C20H24O3Se and a molecular weight of 391.37 g/mol. Its IUPAC name is (1'S,6'S)-3'-phenylselanylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one.
| Compound Name | (1'S,6'S)-3'-phenylselanylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one |
|---|---|
| PubChem CID | 10408121 |
| Molecular Formula | C20H24O3Se |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (1'S,6'S)-3'-phenylselanylspiro[1,3-dioxolane-2,9'-tricyclo[6.3.1.01,6]dodecane]-2'-one |
| SMILES | O=C1C([Se]c2ccccc2)CC[C@H]2CC3C[C@]12CCC31OCCO1 |
| InChI | InChI=1S/C20H24O3Se/c21-18-17(24-16-4-2-1-3-5-16)7-6-14-12-15-13-19(14,18)8-9-20(15)22-10-11-23-20/h1-5,14-15,17H,6-13H2/t14-,15?,17?,19-/m0/s1 |
| InChIKey | CBEMAADZNMJLBU-QSUGNCRHSA-N |
| XLogP | 2.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|