C21H16ClN5O3S — CID 6026852
5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-3-(4-methoxyphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide (PubChem CID 6026852) has the molecular formula C21H16ClN5O3S and a molecular weight of 453.91 g/mol. Its IUPAC name is 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-3-(4-methoxyphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide.
| Compound Name | 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-3-(4-methoxyphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide |
|---|---|
| PubChem CID | 6026852 |
| Molecular Formula | C21H16ClN5O3S |
| Molecular Weight | 453.91 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 5-amino-N-[(Z)-(4-chlorophenyl)methylideneamino]-3-(4-methoxyphenyl)-4-oxothieno[3,4-d]pyridazine-1-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)N/N=C\c3ccc(Cl)cc3)c3csc(N)c3c2=O)cc1 |
| InChI | InChI=1S/C21H16ClN5O3S/c1-30-15-8-6-14(7-9-15)27-21(29)17-16(11-31-19(17)23)18(26-27)20(28)25-24-10-12-2-4-13(22)5-3-12/h2-11H,23H2,1H3,(H,25,28)/b24-10- |
| InChIKey | KIDMIIFBXWVQAG-VROXFSQNSA-N |
| XLogP | 3.46 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|