C19H24N2O4S — CID 6031116
3,4,5-triethoxy-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide (PubChem CID 6031116) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6031116 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3,4,5-triethoxy-N-[(Z)-(3-methylthiophen-2-yl)methylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)N/N=C\c2sccc2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H24N2O4S/c1-5-23-15-10-14(11-16(24-6-2)18(15)25-7-3)19(22)21-20-12-17-13(4)8-9-26-17/h8-12H,5-7H2,1-4H3,(H,21,22)/b20-12- |
| InChIKey | VAQDJTPCAACYLS-NDENLUEZSA-N |
| XLogP | 4.02 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|