C20H15N5O — CID 60506387
N-(1-benzylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-4-amine (PubChem CID 60506387) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(1-benzylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 60506387 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-[1]benzofuro[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(Cn2cc(Nc3ncnc4c3oc3ccccc34)cn2)cc1 |
| InChI | InChI=1S/C20H15N5O/c1-2-6-14(7-3-1)11-25-12-15(10-23-25)24-20-19-18(21-13-22-20)16-8-4-5-9-17(16)26-19/h1-10,12-13H,11H2,(H,21,22,24) |
| InChIKey | KQEFAFMSBVAJBG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |