C20H19N5OS — CID 60507159
N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-2-thiophen-2-ylquinazolin-4-amine (PubChem CID 60507159) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-2-thiophen-2-ylquinazolin-4-amine.
| Compound Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-2-thiophen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 60507159 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[1-(oxolan-2-ylmethyl)pyrazol-4-yl]-2-thiophen-2-ylquinazolin-4-amine |
| SMILES | c1csc(-c2nc(Nc3cnn(CC4CCCO4)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H19N5OS/c1-2-7-17-16(6-1)19(24-20(23-17)18-8-4-10-27-18)22-14-11-21-25(12-14)13-15-5-3-9-26-15/h1-2,4,6-8,10-12,15H,3,5,9,13H2,(H,22,23,24) |
| InChIKey | NSJSAIJHHZGMMZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |