C19H26N6O2S — CID 60508923
N-butyl-1-[(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl]piperidine-4-carboxamide (PubChem CID 60508923) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-butyl-1-[(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-1-[(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60508923 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-butyl-1-[(8-methyl-7-oxo-5-thia-1,8,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,9,11-tetraen-12-yl)methyl]piperidine-4-carboxamide |
| SMILES | CCCCNC(=O)C1CCN(Cc2nnc3n(C)c(=O)c4sccc4n23)CC1 |
| InChI | InChI=1S/C19H26N6O2S/c1-3-4-8-20-17(26)13-5-9-24(10-6-13)12-15-21-22-19-23(2)18(27)16-14(25(15)19)7-11-28-16/h7,11,13H,3-6,8-10,12H2,1-2H3,(H,20,26) |
| InChIKey | GOYJDRGDBGUEBH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|